C10H16F3N — CID 130529098
1,1-di(cyclobutyl)-2,2,2-trifluoroethanamine (PubChem CID 130529098) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is 1,1-di(cyclobutyl)-2,2,2-trifluoroethanamine.
| Compound Name | 1,1-di(cyclobutyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130529098 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1,1-di(cyclobutyl)-2,2,2-trifluoroethanamine |
| SMILES | NC(C1CCC1)(C1CCC1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c11-10(12,13)9(14,7-3-1-4-7)8-5-2-6-8/h7-8H,1-6,14H2 |
| InChIKey | WNHPIINIEWEHMX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |