C8H13N3O2 — CID 130530858
4-(azetidin-3-ylmethyl)piperazine-2,6-dione (PubChem CID 130530858) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethyl)piperazine-2,6-dione.
| Compound Name | 4-(azetidin-3-ylmethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 130530858 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-(azetidin-3-ylmethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(CC2CNC2)CC(=O)N1 |
| InChI | InChI=1S/C8H13N3O2/c12-7-4-11(5-8(13)10-7)3-6-1-9-2-6/h6,9H,1-5H2,(H,10,12,13) |
| InChIKey | BVLAIWXKMRJUCL-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|