C11H19N3O2 — CID 107390973
4-[2-(azetidin-3-yl)ethyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 107390973) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[2-(azetidin-3-yl)ethyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(azetidin-3-yl)ethyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 107390973 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-[2-(azetidin-3-yl)ethyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1CCC1CNC1 |
| InChI | InChI=1S/C11H19N3O2/c1-11(2)10(16)13-9(15)7-14(11)4-3-8-5-12-6-8/h8,12H,3-7H2,1-2H3,(H,13,15,16) |
| InChIKey | DKUMCPUECIIKFW-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|