C10H16N2O4 — CID 107507470
4-(3-methoxy-2-oxopropyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 107507470) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(3-methoxy-2-oxopropyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(3-methoxy-2-oxopropyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 107507470 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-(3-methoxy-2-oxopropyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | COCC(=O)CN1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H16N2O4/c1-10(2)9(15)11-8(14)5-12(10)4-7(13)6-16-3/h4-6H2,1-3H3,(H,11,14,15) |
| InChIKey | AWGPGKQGFBGSRS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|