C12H18N2O4 — CID 77112088
4-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-ethylbut-2-enoic acid (PubChem CID 77112088) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 77112088 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCN1CC(=O)NC(=O)C1(C)C)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-4-8(10(16)17)5-6-14-7-9(15)13-11(18)12(14,2)3/h5H,4,6-7H2,1-3H3,(H,16,17)(H,13,15,18) |
| InChIKey | ZFPQRBFUMSLQFR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|