C6H4Br2N2 — CID 130532154
4-(2,2-dibromoethenyl)pyrimidine (PubChem CID 130532154) has the molecular formula C6H4Br2N2 and a molecular weight of 263.92 g/mol. Its IUPAC name is 4-(2,2-dibromoethenyl)pyrimidine.
| Compound Name | 4-(2,2-dibromoethenyl)pyrimidine |
|---|---|
| PubChem CID | 130532154 |
| Molecular Formula | C6H4Br2N2 |
| Molecular Weight | 263.92 g/mol |
| Exact Mass | 261.87 |
| IUPAC Name | 4-(2,2-dibromoethenyl)pyrimidine |
| SMILES | BrC(Br)=Cc1ccncn1 |
| InChI | InChI=1S/C6H4Br2N2/c7-6(8)3-5-1-2-9-4-10-5/h1-4H |
| InChIKey | BIVQXUCKIIQRID-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.92 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |