C9H8N4S — CID 169049159
4-[(E)-2-pyrimidin-4-ylethenyl]-1,3-thiazol-2-amine (PubChem CID 169049159) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 4-[(E)-2-pyrimidin-4-ylethenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(E)-2-pyrimidin-4-ylethenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 169049159 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-[(E)-2-pyrimidin-4-ylethenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(/C=C/c2ccncn2)cs1 |
| InChI | InChI=1S/C9H8N4S/c10-9-13-8(5-14-9)2-1-7-3-4-11-6-12-7/h1-6H,(H2,10,13)/b2-1+ |
| InChIKey | GMUQFCRAPGHNSV-OWOJBTEDSA-N |
| XLogP | 1.69 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |