C6H6BrN7 — CID 130540599
5-bromo-N-(2H-tetrazol-5-ylmethyl)pyrazin-2-amine (PubChem CID 130540599) has the molecular formula C6H6BrN7 and a molecular weight of 256.07 g/mol. Its IUPAC name is 5-bromo-N-(2H-tetrazol-5-ylmethyl)pyrazin-2-amine.
| Compound Name | 5-bromo-N-(2H-tetrazol-5-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 130540599 |
| Molecular Formula | C6H6BrN7 |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 5-bromo-N-(2H-tetrazol-5-ylmethyl)pyrazin-2-amine |
| SMILES | Brc1cnc(NCc2nn[nH]n2)cn1 |
| InChI | InChI=1S/C6H6BrN7/c7-4-1-9-5(2-8-4)10-3-6-11-13-14-12-6/h1-2H,3H2,(H,9,10)(H,11,12,13,14) |
| InChIKey | RFAAHYQODMPNJU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |