About 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine
3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine (PubChem CID 130556048) has the molecular formula C11H14BrClN2
and a molecular weight of 289.60 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine |
| PubChem CID | 130556048 |
| Molecular Formula | C11H14BrClN2 |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine |
| SMILES | CC1(C)CCC1Nc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C11H14BrClN2/c1-11(2)4-3-9(11)15-10-8(12)5-7(13)6-14-10/h5-6,9H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | OAPAHLOULGLITF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine?
The IUPAC name of 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine (CID 130556048) is 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine.
What is the SMILES notation for 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine?
The canonical SMILES for 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine is CC1(C)CCC1Nc1ncc(Cl)cc1Br.
What is the InChIKey of 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine?
The InChIKey is OAPAHLOULGLITF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrClN2/c1-11(2)4-3-9(11)15-10-8(12)5-7(13)6-14-10/h5-6,9H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine?
3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine has a molecular weight of 289.60 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-N-(2,2-dimethylcyclobutyl)pyridin-2-amine is sourced from PubChem (CID 130556048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).