About 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine
3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine (PubChem CID 130556182) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine |
| PubChem CID | 130556182 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine |
| SMILES | CC1(C)CCC1NCC1(N)CCOC1 |
| InChI | InChI=1S/C11H22N2O/c1-10(2)4-3-9(10)13-7-11(12)5-6-14-8-11/h9,13H,3-8,12H2,1-2H3 |
| InChIKey | NEQYLWYBWRUTHR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine?
The IUPAC name of 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine (CID 130556182) is 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine.
What is the SMILES notation for 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine?
The canonical SMILES for 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine is CC1(C)CCC1NCC1(N)CCOC1.
What is the InChIKey of 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine?
The InChIKey is NEQYLWYBWRUTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-10(2)4-3-9(10)13-7-11(12)5-6-14-8-11/h9,13H,3-8,12H2,1-2H3.
What are the key properties of 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine?
3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine has a molecular weight of 198.31 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2,2-dimethylcyclobutyl)amino]methyl]oxolan-3-amine is sourced from PubChem (CID 130556182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).