C12H23NO2S — CID 106099929
3-[[(4,4-dimethylthian-3-yl)amino]methyl]oxolan-3-ol (PubChem CID 106099929) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 3-[[(4,4-dimethylthian-3-yl)amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[(4,4-dimethylthian-3-yl)amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106099929 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-[[(4,4-dimethylthian-3-yl)amino]methyl]oxolan-3-ol |
| SMILES | CC1(C)CCSCC1NCC1(O)CCOC1 |
| InChI | InChI=1S/C12H23NO2S/c1-11(2)4-6-16-7-10(11)13-8-12(14)3-5-15-9-12/h10,13-14H,3-9H2,1-2H3 |
| InChIKey | ASFJQPVKFFLLLE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |