C14H27NOS — CID 114135823
4,4-dimethyl-N-[2-(oxan-2-yl)ethyl]thian-3-amine (PubChem CID 114135823) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 4,4-dimethyl-N-[2-(oxan-2-yl)ethyl]thian-3-amine.
| Compound Name | 4,4-dimethyl-N-[2-(oxan-2-yl)ethyl]thian-3-amine |
|---|---|
| PubChem CID | 114135823 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4,4-dimethyl-N-[2-(oxan-2-yl)ethyl]thian-3-amine |
| SMILES | CC1(C)CCSCC1NCCC1CCCCO1 |
| InChI | InChI=1S/C14H27NOS/c1-14(2)7-10-17-11-13(14)15-8-6-12-5-3-4-9-16-12/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | UCBHWZXNGVCBJX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |