C19H13ClN2O2 — CID 13055780
(4-chlorophenyl)-(5-methoxyimidazo[1,2-a]quinolin-2-yl)methanone (PubChem CID 13055780) has the molecular formula C19H13ClN2O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is (4-chlorophenyl)-(5-methoxyimidazo[1,2-a]quinolin-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(5-methoxyimidazo[1,2-a]quinolin-2-yl)methanone |
|---|---|
| PubChem CID | 13055780 |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (4-chlorophenyl)-(5-methoxyimidazo[1,2-a]quinolin-2-yl)methanone |
| SMILES | COc1cc2nc(C(=O)c3ccc(Cl)cc3)cn2c2ccccc12 |
| InChI | InChI=1S/C19H13ClN2O2/c1-24-17-10-18-21-15(19(23)12-6-8-13(20)9-7-12)11-22(18)16-5-3-2-4-14(16)17/h2-11H,1H3 |
| InChIKey | JRTKJCRHCWQHMA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |