C8H10BrNO3S2 — CID 130559335
4-bromo-N-(3-hydroxycyclobutyl)thiophene-2-sulfonamide (PubChem CID 130559335) has the molecular formula C8H10BrNO3S2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 4-bromo-N-(3-hydroxycyclobutyl)thiophene-2-sulfonamide.
| Compound Name | 4-bromo-N-(3-hydroxycyclobutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 130559335 |
| Molecular Formula | C8H10BrNO3S2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | 4-bromo-N-(3-hydroxycyclobutyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CC(O)C1)c1cc(Br)cs1 |
| InChI | InChI=1S/C8H10BrNO3S2/c9-5-1-8(14-4-5)15(12,13)10-6-2-7(11)3-6/h1,4,6-7,10-11H,2-3H2 |
| InChIKey | BYASICBTWOJXBN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |