C11H12BrNO3S2 — CID 146135715
N-(4-bromothiophen-2-yl)sulfonylspiro[2.3]hexane-5-carboxamide (PubChem CID 146135715) has the molecular formula C11H12BrNO3S2 and a molecular weight of 350.26 g/mol. Its IUPAC name is N-(4-bromothiophen-2-yl)sulfonylspiro[2.3]hexane-5-carboxamide.
| Compound Name | N-(4-bromothiophen-2-yl)sulfonylspiro[2.3]hexane-5-carboxamide |
|---|---|
| PubChem CID | 146135715 |
| Molecular Formula | C11H12BrNO3S2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | N-(4-bromothiophen-2-yl)sulfonylspiro[2.3]hexane-5-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cc(Br)cs1)C1CC2(CC2)C1 |
| InChI | InChI=1S/C11H12BrNO3S2/c12-8-3-9(17-6-8)18(15,16)13-10(14)7-4-11(5-7)1-2-11/h3,6-7H,1-2,4-5H2,(H,13,14) |
| InChIKey | IKXLARBUTPIXCE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |