C8H13N5O — CID 130559424
1-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-2-one (PubChem CID 130559424) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-2-one.
| Compound Name | 1-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 130559424 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-2-one |
| SMILES | O=C1CNCCN1CCn1cncn1 |
| InChI | InChI=1S/C8H13N5O/c14-8-5-9-1-2-12(8)3-4-13-7-10-6-11-13/h6-7,9H,1-5H2 |
| InChIKey | MNYHAXMGCNOBKQ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |