C14H18FN5 — CID 120756895
2-(3-fluorophenyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]piperazine (PubChem CID 120756895) has the molecular formula C14H18FN5 and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]piperazine.
| Compound Name | 2-(3-fluorophenyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 120756895 |
| Molecular Formula | C14H18FN5 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[2-(1,2,4-triazol-1-yl)ethyl]piperazine |
| SMILES | Fc1cccc(C2CNCCN2CCn2cncn2)c1 |
| InChI | InChI=1S/C14H18FN5/c15-13-3-1-2-12(8-13)14-9-16-4-5-19(14)6-7-20-11-17-10-18-20/h1-3,8,10-11,14,16H,4-7,9H2 |
| InChIKey | WNOLGYSALUACLH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |