C17H23FN4O2 — CID 120756565
3-[2-[2-(3-fluorophenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 120756565) has the molecular formula C17H23FN4O2 and a molecular weight of 334.39 g/mol. Its IUPAC name is 3-[2-[2-(3-fluorophenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[2-(3-fluorophenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120756565 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 3-[2-[2-(3-fluorophenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCN2CCNCC2c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C17H23FN4O2/c1-17(2)15(23)22(16(24)20-17)9-8-21-7-6-19-11-14(21)12-4-3-5-13(18)10-12/h3-5,10,14,19H,6-9,11H2,1-2H3,(H,20,24) |
| InChIKey | PNKVLLHQGXHSPI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|