C19H28N4O2 — CID 120758033
3-[2-[2-(4-ethylphenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 120758033) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[2-[2-(4-ethylphenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[2-(4-ethylphenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120758033 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-[2-[2-(4-ethylphenyl)piperazin-1-yl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCc1ccc(C2CNCCN2CCN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-14-5-7-15(8-6-14)16-13-20-9-10-22(16)11-12-23-17(24)19(2,3)21-18(23)25/h5-8,16,20H,4,9-13H2,1-3H3,(H,21,25) |
| InChIKey | OWCALEKGWTXLLN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|