C22H31ClN4O3 — CID 120741684
3-[3-[2-(4-ethylphenyl)piperazin-1-yl]-3-oxopropyl]-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride (PubChem CID 120741684) has the molecular formula C22H31ClN4O3 and a molecular weight of 434.97 g/mol. Its IUPAC name is 3-[3-[2-(4-ethylphenyl)piperazin-1-yl]-3-oxopropyl]-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride.
| Compound Name | 3-[3-[2-(4-ethylphenyl)piperazin-1-yl]-3-oxopropyl]-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 120741684 |
| Molecular Formula | C22H31ClN4O3 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-[3-[2-(4-ethylphenyl)piperazin-1-yl]-3-oxopropyl]-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CCN2C(=O)NC3(CCCC3)C2=O)cc1.Cl |
| InChI | InChI=1S/C22H30N4O3.ClH/c1-2-16-5-7-17(8-6-16)18-15-23-12-14-25(18)19(27)9-13-26-20(28)22(24-21(26)29)10-3-4-11-22;/h5-8,18,23H,2-4,9-15H2,1H3,(H,24,29);1H |
| InChIKey | ZEPBLJYYLWKAOP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|