C23H35N3O2 — CID 120740827
1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(1-morpholin-4-ylcyclopentyl)ethanone (PubChem CID 120740827) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(1-morpholin-4-ylcyclopentyl)ethanone.
| Compound Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(1-morpholin-4-ylcyclopentyl)ethanone |
|---|---|
| PubChem CID | 120740827 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-[2-(4-ethylphenyl)piperazin-1-yl]-2-(1-morpholin-4-ylcyclopentyl)ethanone |
| SMILES | CCc1ccc(C2CNCCN2C(=O)CC2(N3CCOCC3)CCCC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-2-19-5-7-20(8-6-19)21-18-24-11-12-26(21)22(27)17-23(9-3-4-10-23)25-13-15-28-16-14-25/h5-8,21,24H,2-4,9-18H2,1H3 |
| InChIKey | OBUXJBWZSVGGPN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |