C13H16F4N2 — CID 120756509
2-(3-fluorophenyl)-1-(3,3,3-trifluoropropyl)piperazine (PubChem CID 120756509) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 2-(3-fluorophenyl)-1-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 120756509 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(3,3,3-trifluoropropyl)piperazine |
| SMILES | Fc1cccc(C2CNCCN2CCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F4N2/c14-11-3-1-2-10(8-11)12-9-18-5-7-19(12)6-4-13(15,16)17/h1-3,8,12,18H,4-7,9H2 |
| InChIKey | JPNRQAHTXXNQLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |