About 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine
6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine (PubChem CID 130559595) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine |
| PubChem CID | 130559595 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine |
| SMILES | CC(C)N(C)C1(CN)COCCOC1 |
| InChI | InChI=1S/C10H22N2O2/c1-9(2)12(3)10(6-11)7-13-4-5-14-8-10/h9H,4-8,11H2,1-3H3 |
| InChIKey | OAYACODNIXDUPR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine?
The IUPAC name of 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine (CID 130559595) is 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine.
What is the SMILES notation for 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine?
The canonical SMILES for 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine is CC(C)N(C)C1(CN)COCCOC1.
What is the InChIKey of 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine?
The InChIKey is OAYACODNIXDUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-9(2)12(3)10(6-11)7-13-4-5-14-8-10/h9H,4-8,11H2,1-3H3.
What are the key properties of 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine?
6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine has a molecular weight of 202.30 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-N-methyl-N-propan-2-yl-1,4-dioxepan-6-amine is sourced from PubChem (CID 130559595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).