C9H19NO3 — CID 130559876
(6-propan-2-yloxy-1,4-dioxepan-6-yl)methanamine (PubChem CID 130559876) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (6-propan-2-yloxy-1,4-dioxepan-6-yl)methanamine.
| Compound Name | (6-propan-2-yloxy-1,4-dioxepan-6-yl)methanamine |
|---|---|
| PubChem CID | 130559876 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (6-propan-2-yloxy-1,4-dioxepan-6-yl)methanamine |
| SMILES | CC(C)OC1(CN)COCCOC1 |
| InChI | InChI=1S/C9H19NO3/c1-8(2)13-9(5-10)6-11-3-4-12-7-9/h8H,3-7,10H2,1-2H3 |
| InChIKey | MKEMBOBBVHGVNY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |