About 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol
6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol (PubChem CID 130559898) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol.
Molecular Properties
| Compound Name | 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol |
| PubChem CID | 130559898 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol |
| SMILES | CCC(CN)C1(O)COCCOC1 |
| InChI | InChI=1S/C9H19NO3/c1-2-8(5-10)9(11)6-12-3-4-13-7-9/h8,11H,2-7,10H2,1H3 |
| InChIKey | SBULXNBWBRGSAD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol?
The IUPAC name of 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol (CID 130559898) is 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol.
What is the SMILES notation for 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol?
The canonical SMILES for 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol is CCC(CN)C1(O)COCCOC1.
What is the InChIKey of 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol?
The InChIKey is SBULXNBWBRGSAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-2-8(5-10)9(11)6-12-3-4-13-7-9/h8,11H,2-7,10H2,1H3.
What are the key properties of 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol?
6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol has a molecular weight of 189.25 g/mol, XLogP of -0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-aminobutan-2-yl)-1,4-dioxepan-6-ol is sourced from PubChem (CID 130559898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).