C15H24N2 — CID 130563719
1-N-benzyl-2-N-but-3-enyl-1-N-methylpropane-1,2-diamine (PubChem CID 130563719) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-N-benzyl-2-N-but-3-enyl-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-N-benzyl-2-N-but-3-enyl-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 130563719 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-N-benzyl-2-N-but-3-enyl-1-N-methylpropane-1,2-diamine |
| SMILES | C=CCCNC(C)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H24N2/c1-4-5-11-16-14(2)12-17(3)13-15-9-7-6-8-10-15/h4,6-10,14,16H,1,5,11-13H2,2-3H3 |
| InChIKey | MUZSGKLDQIVBFE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|