C9H12BrN3O — CID 130565497
(5-bromopyrimidin-4-yl)-(oxolan-3-yl)methanamine (PubChem CID 130565497) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is (5-bromopyrimidin-4-yl)-(oxolan-3-yl)methanamine.
| Compound Name | (5-bromopyrimidin-4-yl)-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 130565497 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (5-bromopyrimidin-4-yl)-(oxolan-3-yl)methanamine |
| SMILES | NC(c1ncncc1Br)C1CCOC1 |
| InChI | InChI=1S/C9H12BrN3O/c10-7-3-12-5-13-9(7)8(11)6-1-2-14-4-6/h3,5-6,8H,1-2,4,11H2 |
| InChIKey | QNWYKASUQFWZAF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |