C7H8N6O — CID 130573080
2-(2-methyltetrazol-5-yl)-1-(1H-pyrazol-4-yl)ethanone (PubChem CID 130573080) has the molecular formula C7H8N6O and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-(2-methyltetrazol-5-yl)-1-(1H-pyrazol-4-yl)ethanone.
| Compound Name | 2-(2-methyltetrazol-5-yl)-1-(1H-pyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 130573080 |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-(2-methyltetrazol-5-yl)-1-(1H-pyrazol-4-yl)ethanone |
| SMILES | Cn1nnc(CC(=O)c2cn[nH]c2)n1 |
| InChI | InChI=1S/C7H8N6O/c1-13-11-7(10-12-13)2-6(14)5-3-8-9-4-5/h3-4H,2H2,1H3,(H,8,9) |
| InChIKey | CSTFGEQKWUWXKY-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |