C9H14N2S — CID 130575141
4-(3-ethyl-3-methylazetidin-2-yl)-1,3-thiazole (PubChem CID 130575141) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 4-(3-ethyl-3-methylazetidin-2-yl)-1,3-thiazole.
| Compound Name | 4-(3-ethyl-3-methylazetidin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 130575141 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-(3-ethyl-3-methylazetidin-2-yl)-1,3-thiazole |
| SMILES | CCC1(C)CNC1c1cscn1 |
| InChI | InChI=1S/C9H14N2S/c1-3-9(2)5-10-8(9)7-4-12-6-11-7/h4,6,8,10H,3,5H2,1-2H3 |
| InChIKey | VQTCZXHMHVHXFH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |