About 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid
1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 130575362) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid.
Analyze 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid (CID 130575362) is 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid is NC(c1nccs1)C1(C(=O)O)CCC1.
What is the InChIKey of 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid?
The InChIKey is ZTLOVFVGDQVFIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c10-6(7-11-4-5-14-7)9(8(12)13)2-1-3-9/h4-6H,1-3,10H2,(H,12,13).
What are the key properties of 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid?
1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[amino(1,3-thiazol-2-yl)methyl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 130575362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).