C6H6BrFN2O2 — CID 130577255
1-(2-bromoethyl)-5-fluoropyrimidine-2,4-dione (PubChem CID 130577255) has the molecular formula C6H6BrFN2O2 and a molecular weight of 237.03 g/mol. Its IUPAC name is 1-(2-bromoethyl)-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(2-bromoethyl)-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 130577255 |
| Molecular Formula | C6H6BrFN2O2 |
| Molecular Weight | 237.03 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 1-(2-bromoethyl)-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCBr)cc1F |
| InChI | InChI=1S/C6H6BrFN2O2/c7-1-2-10-3-4(8)5(11)9-6(10)12/h3H,1-2H2,(H,9,11,12) |
| InChIKey | QXISKGYVJDVOMC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.03 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|