C11H17NO2 — CID 130578957
3-(2,3-dihydrofuran-4-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 130578957) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(2,3-dihydrofuran-4-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,3-dihydrofuran-4-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 130578957 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(2,3-dihydrofuran-4-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(C2=COCC2)CC2CCC(C1)N2 |
| InChI | InChI=1S/C11H17NO2/c13-11(8-3-4-14-7-8)5-9-1-2-10(6-11)12-9/h7,9-10,12-13H,1-6H2 |
| InChIKey | PTDWWNUCCNYLIO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |