C10H14O2 — CID 130579403
2-cyclobutyl-1-(2,3-dihydrofuran-4-yl)ethanone (PubChem CID 130579403) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-cyclobutyl-1-(2,3-dihydrofuran-4-yl)ethanone.
| Compound Name | 2-cyclobutyl-1-(2,3-dihydrofuran-4-yl)ethanone |
|---|---|
| PubChem CID | 130579403 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-cyclobutyl-1-(2,3-dihydrofuran-4-yl)ethanone |
| SMILES | O=C(CC1CCC1)C1=COCC1 |
| InChI | InChI=1S/C10H14O2/c11-10(6-8-2-1-3-8)9-4-5-12-7-9/h7-8H,1-6H2 |
| InChIKey | MYQXOJDIWLARGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |