C11H16O2 — CID 103168064
2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanone (PubChem CID 103168064) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanone.
| Compound Name | 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanone |
|---|---|
| PubChem CID | 103168064 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-cyclobutyl-1-(3,4-dihydro-2H-pyran-5-yl)ethanone |
| SMILES | O=C(CC1CCC1)C1=COCCC1 |
| InChI | InChI=1S/C11H16O2/c12-11(7-9-3-1-4-9)10-5-2-6-13-8-10/h8-9H,1-7H2 |
| InChIKey | HOJNRFYHWKFHEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |