4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid

C11H17NO4 — CID 115923971

IUPAC4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)C1=COCCC1
InChIInChI=1S/C11H17NO4/c1-8(4-5-10(13)14)12-11(15)9-3-2-6-16-7-9/h7-8H,2-6H2,1H3,(H,12,15)(H,13,14)
InChIKeySORDDZMOQGRGKA-UHFFFAOYSA-N
MW227.26 g/mol
LogP1.05
Rot. Bonds5

About 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid

4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid (PubChem CID 115923971) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid.

Molecular Properties

Compound Name4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid
PubChem CID115923971
Molecular FormulaC11H17NO4
Molecular Weight227.26 g/mol
Exact Mass227.12
IUPAC Name4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)C1=COCCC1
InChIInChI=1S/C11H17NO4/c1-8(4-5-10(13)14)12-11(15)9-3-2-6-16-7-9/h7-8H,2-6H2,1H3,(H,12,15)(H,13,14)
InChIKeySORDDZMOQGRGKA-UHFFFAOYSA-N
XLogP1.05
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.26
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid?
The IUPAC name of 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid (CID 115923971) is 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid.
What is the SMILES notation for 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid?
The canonical SMILES for 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid is CC(CCC(=O)O)NC(=O)C1=COCCC1.
What is the InChIKey of 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid?
The InChIKey is SORDDZMOQGRGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-8(4-5-10(13)14)12-11(15)9-3-2-6-16-7-9/h7-8H,2-6H2,1H3,(H,12,15)(H,13,14).
What are the key properties of 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid?
4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid has a molecular weight of 227.26 g/mol, XLogP of 1.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-pyran-5-carbonylamino)pentanoic acid is sourced from PubChem (CID 115923971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).