C8H11NO4 — CID 103791046
(2S)-2-(2,3-dihydrofuran-4-carbonylamino)propanoic acid (PubChem CID 103791046) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydrofuran-4-carbonylamino)propanoic acid.
| Compound Name | (2S)-2-(2,3-dihydrofuran-4-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 103791046 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (2S)-2-(2,3-dihydrofuran-4-carbonylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)C1=COCC1)C(=O)O |
| InChI | InChI=1S/C8H11NO4/c1-5(8(11)12)9-7(10)6-2-3-13-4-6/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | YGKHHEXHZQWFGM-YFKPBYRVSA-N |
| XLogP | -0.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |