C12H21NO — CID 130579902
2-cyclohexyl-1-(2,3-dihydrofuran-4-yl)ethanamine (PubChem CID 130579902) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2,3-dihydrofuran-4-yl)ethanamine.
| Compound Name | 2-cyclohexyl-1-(2,3-dihydrofuran-4-yl)ethanamine |
|---|---|
| PubChem CID | 130579902 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-cyclohexyl-1-(2,3-dihydrofuran-4-yl)ethanamine |
| SMILES | NC(CC1CCCCC1)C1=COCC1 |
| InChI | InChI=1S/C12H21NO/c13-12(11-6-7-14-9-11)8-10-4-2-1-3-5-10/h9-10,12H,1-8,13H2 |
| InChIKey | CLMCWKAFRORKAO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |