C12H20O2 — CID 130580063
2,3-dihydrofuran-4-yl-(1-ethylcyclopentyl)methanol (PubChem CID 130580063) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2,3-dihydrofuran-4-yl-(1-ethylcyclopentyl)methanol.
| Compound Name | 2,3-dihydrofuran-4-yl-(1-ethylcyclopentyl)methanol |
|---|---|
| PubChem CID | 130580063 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2,3-dihydrofuran-4-yl-(1-ethylcyclopentyl)methanol |
| SMILES | CCC1(C(O)C2=COCC2)CCCC1 |
| InChI | InChI=1S/C12H20O2/c1-2-12(6-3-4-7-12)11(13)10-5-8-14-9-10/h9,11,13H,2-8H2,1H3 |
| InChIKey | LLARRKHURBZARR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |