C10H16O3 — CID 164579757
3-methylidenespiro[4.4]nonane-1,4,9-triol (PubChem CID 164579757) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 3-methylidenespiro[4.4]nonane-1,4,9-triol.
| Compound Name | 3-methylidenespiro[4.4]nonane-1,4,9-triol |
|---|---|
| PubChem CID | 164579757 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 3-methylidenespiro[4.4]nonane-1,4,9-triol |
| SMILES | C=C1CC(O)C2(CCCC2O)C1O |
| InChI | InChI=1S/C10H16O3/c1-6-5-8(12)10(9(6)13)4-2-3-7(10)11/h7-9,11-13H,1-5H2 |
| InChIKey | QOCNKAQVUSCEMQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|