C11H18O3 — CID 171798128
8-(hydroxymethyl)spiro[4.5]dec-8-ene-1,4-diol (PubChem CID 171798128) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 8-(hydroxymethyl)spiro[4.5]dec-8-ene-1,4-diol.
| Compound Name | 8-(hydroxymethyl)spiro[4.5]dec-8-ene-1,4-diol |
|---|---|
| PubChem CID | 171798128 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 8-(hydroxymethyl)spiro[4.5]dec-8-ene-1,4-diol |
| SMILES | OCC1=CCC2(CC1)C(O)CCC2O |
| InChI | InChI=1S/C11H18O3/c12-7-8-3-5-11(6-4-8)9(13)1-2-10(11)14/h3,9-10,12-14H,1-2,4-7H2 |
| InChIKey | CTZLPEADPUYSPM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|