C13H24O3 — CID 86145259
1-(3-hydroxybutyl)-2,6,6-trimethylcyclohex-2-ene-1,4-diol (PubChem CID 86145259) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-2,6,6-trimethylcyclohex-2-ene-1,4-diol.
| Compound Name | 1-(3-hydroxybutyl)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 86145259 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(3-hydroxybutyl)-2,6,6-trimethylcyclohex-2-ene-1,4-diol |
| SMILES | CC1=CC(O)CC(C)(C)C1(O)CCC(C)O |
| InChI | InChI=1S/C13H24O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h7,10-11,14-16H,5-6,8H2,1-4H3 |
| InChIKey | JZLWGWGGZALHGM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|