C11H18O2 — CID 141073739
8-methylidenespiro[4.5]decane-1,4-diol (PubChem CID 141073739) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 8-methylidenespiro[4.5]decane-1,4-diol.
| Compound Name | 8-methylidenespiro[4.5]decane-1,4-diol |
|---|---|
| PubChem CID | 141073739 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 8-methylidenespiro[4.5]decane-1,4-diol |
| SMILES | C=C1CCC2(CC1)C(O)CCC2O |
| InChI | InChI=1S/C11H18O2/c1-8-4-6-11(7-5-8)9(12)2-3-10(11)13/h9-10,12-13H,1-7H2 |
| InChIKey | DEPGSCNRKAWFGI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|