C10H18O2 — CID 141042153
spiro[4.5]decane-1,4-diol (PubChem CID 141042153) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is spiro[4.5]decane-1,4-diol.
| Compound Name | spiro[4.5]decane-1,4-diol |
|---|---|
| PubChem CID | 141042153 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | spiro[4.5]decane-1,4-diol |
| SMILES | OC1CCC(O)C12CCCCC2 |
| InChI | InChI=1S/C10H18O2/c11-8-4-5-9(12)10(8)6-2-1-3-7-10/h8-9,11-12H,1-7H2 |
| InChIKey | QNROYLVFOGKDOP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |