C11H18O3 — CID 130580072
1-(2,3-dihydrofuran-4-yl)-2-(oxan-2-yl)ethanol (PubChem CID 130580072) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-4-yl)-2-(oxan-2-yl)ethanol.
| Compound Name | 1-(2,3-dihydrofuran-4-yl)-2-(oxan-2-yl)ethanol |
|---|---|
| PubChem CID | 130580072 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-(2,3-dihydrofuran-4-yl)-2-(oxan-2-yl)ethanol |
| SMILES | OC(CC1CCCCO1)C1=COCC1 |
| InChI | InChI=1S/C11H18O3/c12-11(9-4-6-13-8-9)7-10-3-1-2-5-14-10/h8,10-12H,1-7H2 |
| InChIKey | JBBDBZLJJZWUMH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |