C10H13N3O2 — CID 130591579
1-[methyl(pyrimidin-4-yl)amino]cyclobutane-1-carboxylic acid (PubChem CID 130591579) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-[methyl(pyrimidin-4-yl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[methyl(pyrimidin-4-yl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 130591579 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-[methyl(pyrimidin-4-yl)amino]cyclobutane-1-carboxylic acid |
| SMILES | CN(c1ccncn1)C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C10H13N3O2/c1-13(8-3-6-11-7-12-8)10(9(14)15)4-2-5-10/h3,6-7H,2,4-5H2,1H3,(H,14,15) |
| InChIKey | MDUVRIAAKKEDTN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |