C8H10N4O3 — CID 96614711
3-[carbamoyl(pyrimidin-4-yl)amino]propanoic acid (PubChem CID 96614711) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-[carbamoyl(pyrimidin-4-yl)amino]propanoic acid.
| Compound Name | 3-[carbamoyl(pyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 96614711 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-[carbamoyl(pyrimidin-4-yl)amino]propanoic acid |
| SMILES | NC(=O)N(CCC(=O)O)c1ccncn1 |
| InChI | InChI=1S/C8H10N4O3/c9-8(15)12(4-2-7(13)14)6-1-3-10-5-11-6/h1,3,5H,2,4H2,(H2,9,15)(H,13,14) |
| InChIKey | SOYJXDDPKVGOKS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |