C10H17BrN4 — CID 130592173
4-(bromomethyl)-1-[(2-methyltriazol-4-yl)methyl]piperidine (PubChem CID 130592173) has the molecular formula C10H17BrN4 and a molecular weight of 273.18 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[(2-methyltriazol-4-yl)methyl]piperidine.
| Compound Name | 4-(bromomethyl)-1-[(2-methyltriazol-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 130592173 |
| Molecular Formula | C10H17BrN4 |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-(bromomethyl)-1-[(2-methyltriazol-4-yl)methyl]piperidine |
| SMILES | Cn1ncc(CN2CCC(CBr)CC2)n1 |
| InChI | InChI=1S/C10H17BrN4/c1-14-12-7-10(13-14)8-15-4-2-9(6-11)3-5-15/h7,9H,2-6,8H2,1H3 |
| InChIKey | XQOBXXUFWWMSBD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|