C7H9BrN2 — CID 130595273
2-bromo-N,5-dimethylpyridin-3-amine (PubChem CID 130595273) has the molecular formula C7H9BrN2 and a molecular weight of 201.07 g/mol. Its IUPAC name is 2-bromo-N,5-dimethylpyridin-3-amine.
| Compound Name | 2-bromo-N,5-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 130595273 |
| Molecular Formula | C7H9BrN2 |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2-bromo-N,5-dimethylpyridin-3-amine |
| SMILES | CNc1cc(C)cnc1Br |
| InChI | InChI=1S/C7H9BrN2/c1-5-3-6(9-2)7(8)10-4-5/h3-4,9H,1-2H3 |
| InChIKey | QDPYAJIFIKHLEP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|