C8H11BrN2 — CID 169191403
3-bromo-1-N,5-dimethylbenzene-1,2-diamine (PubChem CID 169191403) has the molecular formula C8H11BrN2 and a molecular weight of 215.09 g/mol. Its IUPAC name is 3-bromo-1-N,5-dimethylbenzene-1,2-diamine.
| Compound Name | 3-bromo-1-N,5-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 169191403 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3-bromo-1-N,5-dimethylbenzene-1,2-diamine |
| SMILES | CNc1cc(C)cc(Br)c1N |
| InChI | InChI=1S/C8H11BrN2/c1-5-3-6(9)8(10)7(4-5)11-2/h3-4,11H,10H2,1-2H3 |
| InChIKey | XZUOMQOWPGDMNC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|