C9H18ClNO2S — CID 130596221
N-[(4,4-dimethylcyclohexyl)methyl]sulfamoyl chloride (PubChem CID 130596221) has the molecular formula C9H18ClNO2S and a molecular weight of 239.77 g/mol. Its IUPAC name is N-[(4,4-dimethylcyclohexyl)methyl]sulfamoyl chloride.
| Compound Name | N-[(4,4-dimethylcyclohexyl)methyl]sulfamoyl chloride |
|---|---|
| PubChem CID | 130596221 |
| Molecular Formula | C9H18ClNO2S |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[(4,4-dimethylcyclohexyl)methyl]sulfamoyl chloride |
| SMILES | CC1(C)CCC(CNS(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C9H18ClNO2S/c1-9(2)5-3-8(4-6-9)7-11-14(10,12)13/h8,11H,3-7H2,1-2H3 |
| InChIKey | RDUYRKYNSLAZCU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |